C21H17F2NO — CID 139205040
N-(2-benzhydryl-4,5-difluorophenyl)acetamide (PubChem CID 139205040) has the molecular formula C21H17F2NO and a molecular weight of 337.37 g/mol. Its IUPAC name is N-(2-benzhydryl-4,5-difluorophenyl)acetamide.
| Compound Name | N-(2-benzhydryl-4,5-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 139205040 |
| Molecular Formula | C21H17F2NO |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | N-(2-benzhydryl-4,5-difluorophenyl)acetamide |
| SMILES | CC(=O)Nc1cc(F)c(F)cc1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H17F2NO/c1-14(25)24-20-13-19(23)18(22)12-17(20)21(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-13,21H,1H3,(H,24,25) |
| InChIKey | FMMRRPMEOGGZTO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|