C15H26O5 — CID 139210701
(E,5S)-5-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-5-(methoxymethoxy)pent-2-en-1-ol (PubChem CID 139210701) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is (E,5S)-5-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-5-(methoxymethoxy)pent-2-en-1-ol.
| Compound Name | (E,5S)-5-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-5-(methoxymethoxy)pent-2-en-1-ol |
|---|---|
| PubChem CID | 139210701 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | (E,5S)-5-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-5-(methoxymethoxy)pent-2-en-1-ol |
| SMILES | COCO[C@@H](C/C=C/CO)[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C15H26O5/c1-17-12-18-13(7-3-6-10-16)14-11-19-15(20-14)8-4-2-5-9-15/h3,6,13-14,16H,2,4-5,7-12H2,1H3/b6-3+/t13-,14+/m0/s1 |
| InChIKey | JTKBLHRAEHXSOP-DZYGNGBISA-N |
| XLogP | 1.99 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|