C17H19N6O2- — CID 139212920
[1-[2-amino-4-(methylcarbamoyl)phenyl]-6,6-dimethyl-4-oxo-5,7-dihydroindazol-3-yl]iminoazanide (PubChem CID 139212920) has the molecular formula C17H19N6O2- and a molecular weight of 339.38 g/mol. Its IUPAC name is [1-[2-amino-4-(methylcarbamoyl)phenyl]-6,6-dimethyl-4-oxo-5,7-dihydroindazol-3-yl]iminoazanide.
| Compound Name | [1-[2-amino-4-(methylcarbamoyl)phenyl]-6,6-dimethyl-4-oxo-5,7-dihydroindazol-3-yl]iminoazanide |
|---|---|
| PubChem CID | 139212920 |
| Molecular Formula | C17H19N6O2- |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | [1-[2-amino-4-(methylcarbamoyl)phenyl]-6,6-dimethyl-4-oxo-5,7-dihydroindazol-3-yl]iminoazanide |
| SMILES | CNC(=O)c1ccc(-n2nc(N=[N-])c3c2CC(C)(C)CC3=O)c(N)c1 |
| InChI | InChI=1S/C17H19N6O2/c1-17(2)7-12-14(13(24)8-17)15(21-19)22-23(12)11-5-4-9(6-10(11)18)16(25)20-3/h4-6H,7-8,18H2,1-3H3,(H,20,25)/q-1 |
| InChIKey | WODFWCLJYSUKFE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 124.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|