C28H32N4O6 — CID 139254101
4-[3-[(3,4-dimethoxyphenyl)methyl]-6,6-dimethyl-4-oxo-5,7-dihydroindazol-1-yl]-3-nitro-N-propylbenzamide (PubChem CID 139254101) has the molecular formula C28H32N4O6 and a molecular weight of 520.59 g/mol. Its IUPAC name is 4-[3-[(3,4-dimethoxyphenyl)methyl]-6,6-dimethyl-4-oxo-5,7-dihydroindazol-1-yl]-3-nitro-N-propylbenzamide.
| Compound Name | 4-[3-[(3,4-dimethoxyphenyl)methyl]-6,6-dimethyl-4-oxo-5,7-dihydroindazol-1-yl]-3-nitro-N-propylbenzamide |
|---|---|
| PubChem CID | 139254101 |
| Molecular Formula | C28H32N4O6 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | 4-[3-[(3,4-dimethoxyphenyl)methyl]-6,6-dimethyl-4-oxo-5,7-dihydroindazol-1-yl]-3-nitro-N-propylbenzamide |
| SMILES | CCCNC(=O)c1ccc(-n2nc(Cc3ccc(OC)c(OC)c3)c3c2CC(C)(C)CC3=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H32N4O6/c1-6-11-29-27(34)18-8-9-20(21(14-18)32(35)36)31-22-15-28(2,3)16-23(33)26(22)19(30-31)12-17-7-10-24(37-4)25(13-17)38-5/h7-10,13-14H,6,11-12,15-16H2,1-5H3,(H,29,34) |
| InChIKey | UBVSDPIUSIGFPD-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|