C25H26N4O5 — CID 139254087
4-(6,6-dimethyl-4-oxo-3-phenyl-5,7-dihydroindazol-1-yl)-N-(2-methoxyethyl)-3-nitrobenzamide (PubChem CID 139254087) has the molecular formula C25H26N4O5 and a molecular weight of 462.51 g/mol. Its IUPAC name is 4-(6,6-dimethyl-4-oxo-3-phenyl-5,7-dihydroindazol-1-yl)-N-(2-methoxyethyl)-3-nitrobenzamide.
| Compound Name | 4-(6,6-dimethyl-4-oxo-3-phenyl-5,7-dihydroindazol-1-yl)-N-(2-methoxyethyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 139254087 |
| Molecular Formula | C25H26N4O5 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 4-(6,6-dimethyl-4-oxo-3-phenyl-5,7-dihydroindazol-1-yl)-N-(2-methoxyethyl)-3-nitrobenzamide |
| SMILES | COCCNC(=O)c1ccc(-n2nc(-c3ccccc3)c3c2CC(C)(C)CC3=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H26N4O5/c1-25(2)14-20-22(21(30)15-25)23(16-7-5-4-6-8-16)27-28(20)18-10-9-17(13-19(18)29(32)33)24(31)26-11-12-34-3/h4-10,13H,11-12,14-15H2,1-3H3,(H,26,31) |
| InChIKey | DLZUEFCVHUUNBN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|