C23H28N4O6 — CID 139254089
4-[6,6-dimethyl-4-oxo-3-(oxolan-2-yl)-5,7-dihydroindazol-1-yl]-N-(2-methoxyethyl)-3-nitrobenzamide (PubChem CID 139254089) has the molecular formula C23H28N4O6 and a molecular weight of 456.50 g/mol. Its IUPAC name is 4-[6,6-dimethyl-4-oxo-3-(oxolan-2-yl)-5,7-dihydroindazol-1-yl]-N-(2-methoxyethyl)-3-nitrobenzamide.
| Compound Name | 4-[6,6-dimethyl-4-oxo-3-(oxolan-2-yl)-5,7-dihydroindazol-1-yl]-N-(2-methoxyethyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 139254089 |
| Molecular Formula | C23H28N4O6 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 4-[6,6-dimethyl-4-oxo-3-(oxolan-2-yl)-5,7-dihydroindazol-1-yl]-N-(2-methoxyethyl)-3-nitrobenzamide |
| SMILES | COCCNC(=O)c1ccc(-n2nc(C3CCCO3)c3c2CC(C)(C)CC3=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H28N4O6/c1-23(2)12-17-20(18(28)13-23)21(19-5-4-9-33-19)25-26(17)15-7-6-14(11-16(15)27(30)31)22(29)24-8-10-32-3/h6-7,11,19H,4-5,8-10,12-13H2,1-3H3,(H,24,29) |
| InChIKey | ZSCJOJXWHCQFPB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|