C28H30N4O4 — CID 139212937
N-benzyl-4-(3-but-3-enyl-6,6-dimethyl-4-oxo-5,7-dihydroindazol-1-yl)-N-methyl-3-nitrobenzamide (PubChem CID 139212937) has the molecular formula C28H30N4O4 and a molecular weight of 486.57 g/mol. Its IUPAC name is N-benzyl-4-(3-but-3-enyl-6,6-dimethyl-4-oxo-5,7-dihydroindazol-1-yl)-N-methyl-3-nitrobenzamide.
| Compound Name | N-benzyl-4-(3-but-3-enyl-6,6-dimethyl-4-oxo-5,7-dihydroindazol-1-yl)-N-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 139212937 |
| Molecular Formula | C28H30N4O4 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | N-benzyl-4-(3-but-3-enyl-6,6-dimethyl-4-oxo-5,7-dihydroindazol-1-yl)-N-methyl-3-nitrobenzamide |
| SMILES | C=CCCc1nn(-c2ccc(C(=O)N(C)Cc3ccccc3)cc2[N+](=O)[O-])c2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C28H30N4O4/c1-5-6-12-21-26-24(16-28(2,3)17-25(26)33)31(29-21)22-14-13-20(15-23(22)32(35)36)27(34)30(4)18-19-10-8-7-9-11-19/h5,7-11,13-15H,1,6,12,16-18H2,2-4H3 |
| InChIKey | PHBVKZSIPWWZOM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 98.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|