C29H25FN4O4 — CID 139254104
4-(6,6-dimethyl-4-oxo-3-phenyl-5,7-dihydroindazol-1-yl)-N-[(4-fluorophenyl)methyl]-3-nitrobenzamide (PubChem CID 139254104) has the molecular formula C29H25FN4O4 and a molecular weight of 512.54 g/mol. Its IUPAC name is 4-(6,6-dimethyl-4-oxo-3-phenyl-5,7-dihydroindazol-1-yl)-N-[(4-fluorophenyl)methyl]-3-nitrobenzamide.
| Compound Name | 4-(6,6-dimethyl-4-oxo-3-phenyl-5,7-dihydroindazol-1-yl)-N-[(4-fluorophenyl)methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 139254104 |
| Molecular Formula | C29H25FN4O4 |
| Molecular Weight | 512.54 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 4-(6,6-dimethyl-4-oxo-3-phenyl-5,7-dihydroindazol-1-yl)-N-[(4-fluorophenyl)methyl]-3-nitrobenzamide |
| SMILES | CC1(C)CC(=O)c2c(-c3ccccc3)nn(-c3ccc(C(=O)NCc4ccc(F)cc4)cc3[N+](=O)[O-])c2C1 |
| InChI | InChI=1S/C29H25FN4O4/c1-29(2)15-24-26(25(35)16-29)27(19-6-4-3-5-7-19)32-33(24)22-13-10-20(14-23(22)34(37)38)28(36)31-17-18-8-11-21(30)12-9-18/h3-14H,15-17H2,1-2H3,(H,31,36) |
| InChIKey | JHQAQUTVEQBSOK-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.54 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|