C28H32N4O4 — CID 139254148
3-amino-4-[6,6-dimethyl-4-oxo-3-(oxolan-2-yl)-5,7-dihydroindazol-1-yl]-N-[(4-methoxyphenyl)methyl]benzamide (PubChem CID 139254148) has the molecular formula C28H32N4O4 and a molecular weight of 488.59 g/mol. Its IUPAC name is 3-amino-4-[6,6-dimethyl-4-oxo-3-(oxolan-2-yl)-5,7-dihydroindazol-1-yl]-N-[(4-methoxyphenyl)methyl]benzamide.
| Compound Name | 3-amino-4-[6,6-dimethyl-4-oxo-3-(oxolan-2-yl)-5,7-dihydroindazol-1-yl]-N-[(4-methoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 139254148 |
| Molecular Formula | C28H32N4O4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | 3-amino-4-[6,6-dimethyl-4-oxo-3-(oxolan-2-yl)-5,7-dihydroindazol-1-yl]-N-[(4-methoxyphenyl)methyl]benzamide |
| SMILES | COc1ccc(CNC(=O)c2ccc(-n3nc(C4CCCO4)c4c3CC(C)(C)CC4=O)c(N)c2)cc1 |
| InChI | InChI=1S/C28H32N4O4/c1-28(2)14-22-25(23(33)15-28)26(24-5-4-12-36-24)31-32(22)21-11-8-18(13-20(21)29)27(34)30-16-17-6-9-19(35-3)10-7-17/h6-11,13,24H,4-5,12,14-16,29H2,1-3H3,(H,30,34) |
| InChIKey | LSBJYVPDHPDOLQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|