C27H28N2O3 — CID 139213156
6-[1-[(3-ethynylphenyl)diazenyl]naphthalen-2-yl]oxyhexyl propanoate (PubChem CID 139213156) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is 6-[1-[(3-ethynylphenyl)diazenyl]naphthalen-2-yl]oxyhexyl propanoate.
| Compound Name | 6-[1-[(3-ethynylphenyl)diazenyl]naphthalen-2-yl]oxyhexyl propanoate |
|---|---|
| PubChem CID | 139213156 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 6-[1-[(3-ethynylphenyl)diazenyl]naphthalen-2-yl]oxyhexyl propanoate |
| SMILES | C#Cc1cccc(/N=N/c2c(OCCCCCCOC(=O)CC)ccc3ccccc23)c1 |
| InChI | InChI=1S/C27H28N2O3/c1-3-21-12-11-14-23(20-21)28-29-27-24-15-8-7-13-22(24)16-17-25(27)31-18-9-5-6-10-19-32-26(30)4-2/h1,7-8,11-17,20H,4-6,9-10,18-19H2,2H3/b29-28+ |
| InChIKey | AJROZKVWBCCFIB-ZQHSETAFSA-N |
| XLogP | 7.13 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|