C7H11NO2S2 — CID 139215593
2,4-dioxopentan-3-yl N-methylcarbamodithioate (PubChem CID 139215593) has the molecular formula C7H11NO2S2 and a molecular weight of 205.30 g/mol. Its IUPAC name is 2,4-dioxopentan-3-yl N-methylcarbamodithioate.
| Compound Name | 2,4-dioxopentan-3-yl N-methylcarbamodithioate |
|---|---|
| PubChem CID | 139215593 |
| Molecular Formula | C7H11NO2S2 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.02 |
| IUPAC Name | 2,4-dioxopentan-3-yl N-methylcarbamodithioate |
| SMILES | CNC(=S)SC(C(C)=O)C(C)=O |
| InChI | InChI=1S/C7H11NO2S2/c1-4(9)6(5(2)10)12-7(11)8-3/h6H,1-3H3,(H,8,11) |
| InChIKey | MWDNKLQCJHDGRL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|