C13H14N3O5+ — CID 139216585
2-amino-4a,9b-dihydroxy-3-methyl-5-oxo-1,4-dihydroindeno[1,2-d]pyrimidin-3-ium-4-carboxylic acid (PubChem CID 139216585) has the molecular formula C13H14N3O5+ and a molecular weight of 292.27 g/mol. Its IUPAC name is 2-amino-4a,9b-dihydroxy-3-methyl-5-oxo-1,4-dihydroindeno[1,2-d]pyrimidin-3-ium-4-carboxylic acid.
| Compound Name | 2-amino-4a,9b-dihydroxy-3-methyl-5-oxo-1,4-dihydroindeno[1,2-d]pyrimidin-3-ium-4-carboxylic acid |
|---|---|
| PubChem CID | 139216585 |
| Molecular Formula | C13H14N3O5+ |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 2-amino-4a,9b-dihydroxy-3-methyl-5-oxo-1,4-dihydroindeno[1,2-d]pyrimidin-3-ium-4-carboxylic acid |
| SMILES | C[N+]1=C(N)NC2(O)c3ccccc3C(=O)C2(O)C1C(=O)O |
| InChI | InChI=1S/C13H13N3O5/c1-16-8(10(18)19)12(20)9(17)6-4-2-3-5-7(6)13(12,21)15-11(16)14/h2-5,8,20-21H,1H3,(H3,14,15,18,19)/p+1 |
| InChIKey | HZZLUUXXWCRBSZ-UHFFFAOYSA-O |
| XLogP | -2.23 |
| TPSA | 135.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|