C16H13ClN2O2 — CID 139218359
6-chloro-4-ethyl-10,18-dioxa-3,5-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),2(7),3,5,12,14,16-heptaene (PubChem CID 139218359) has the molecular formula C16H13ClN2O2 and a molecular weight of 300.75 g/mol. Its IUPAC name is 6-chloro-4-ethyl-10,18-dioxa-3,5-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),2(7),3,5,12,14,16-heptaene.
| Compound Name | 6-chloro-4-ethyl-10,18-dioxa-3,5-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),2(7),3,5,12,14,16-heptaene |
|---|---|
| PubChem CID | 139218359 |
| Molecular Formula | C16H13ClN2O2 |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 6-chloro-4-ethyl-10,18-dioxa-3,5-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(11),2(7),3,5,12,14,16-heptaene |
| SMILES | CCc1nc(Cl)c2c(n1)-c1oc3ccccc3c1OCC2 |
| InChI | InChI=1S/C16H13ClN2O2/c1-2-12-18-13-10(16(17)19-12)7-8-20-14-9-5-3-4-6-11(9)21-15(13)14/h3-6H,2,7-8H2,1H3 |
| InChIKey | RNSSIGTXFXPBLL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |