C12H10ClNO2 — CID 15749818
4-chloro-6-methoxy-2,3-dihydrofuro[3,2-c]quinoline (PubChem CID 15749818) has the molecular formula C12H10ClNO2 and a molecular weight of 235.67 g/mol. Its IUPAC name is 4-chloro-6-methoxy-2,3-dihydrofuro[3,2-c]quinoline.
| Compound Name | 4-chloro-6-methoxy-2,3-dihydrofuro[3,2-c]quinoline |
|---|---|
| PubChem CID | 15749818 |
| Molecular Formula | C12H10ClNO2 |
| Molecular Weight | 235.67 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 4-chloro-6-methoxy-2,3-dihydrofuro[3,2-c]quinoline |
| SMILES | COc1cccc2c3c(c(Cl)nc12)CCO3 |
| InChI | InChI=1S/C12H10ClNO2/c1-15-9-4-2-3-7-10(9)14-12(13)8-5-6-16-11(7)8/h2-4H,5-6H2,1H3 |
| InChIKey | RAIHNJPXCGBXTE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.67 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|