C28H20N4O4S — CID 139223060
4-[3-methyl-1-(3-nitrophenyl)pyrazolo[5,4-b]pyridin-5-yl]-3-phenylsulfanyl-4a,8a-dihydrochromen-2-one (PubChem CID 139223060) has the molecular formula C28H20N4O4S and a molecular weight of 508.56 g/mol. Its IUPAC name is 4-[3-methyl-1-(3-nitrophenyl)pyrazolo[5,4-b]pyridin-5-yl]-3-phenylsulfanyl-4a,8a-dihydrochromen-2-one.
| Compound Name | 4-[3-methyl-1-(3-nitrophenyl)pyrazolo[5,4-b]pyridin-5-yl]-3-phenylsulfanyl-4a,8a-dihydrochromen-2-one |
|---|---|
| PubChem CID | 139223060 |
| Molecular Formula | C28H20N4O4S |
| Molecular Weight | 508.56 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | 4-[3-methyl-1-(3-nitrophenyl)pyrazolo[5,4-b]pyridin-5-yl]-3-phenylsulfanyl-4a,8a-dihydrochromen-2-one |
| SMILES | Cc1nn(-c2cccc([N+](=O)[O-])c2)c2ncc(C3=C(Sc4ccccc4)C(=O)OC4C=CC=CC34)cc12 |
| InChI | InChI=1S/C28H20N4O4S/c1-17-23-14-18(16-29-27(23)31(30-17)19-8-7-9-20(15-19)32(34)35)25-22-12-5-6-13-24(22)36-28(33)26(25)37-21-10-3-2-4-11-21/h2-16,22,24H,1H3 |
| InChIKey | PUCWDRKWYXHHSA-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 100.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.56 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|