C24H29N3O2 — CID 139227627
N-(4'-tert-butyl-4-oxospiro[1H-quinazoline-2,1'-cyclohexane]-3-yl)benzamide (PubChem CID 139227627) has the molecular formula C24H29N3O2 and a molecular weight of 391.51 g/mol. Its IUPAC name is N-(4'-tert-butyl-4-oxospiro[1H-quinazoline-2,1'-cyclohexane]-3-yl)benzamide.
| Compound Name | N-(4'-tert-butyl-4-oxospiro[1H-quinazoline-2,1'-cyclohexane]-3-yl)benzamide |
|---|---|
| PubChem CID | 139227627 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | N-(4'-tert-butyl-4-oxospiro[1H-quinazoline-2,1'-cyclohexane]-3-yl)benzamide |
| SMILES | CC(C)(C)C1CCC2(CC1)Nc1ccccc1C(=O)N2NC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H29N3O2/c1-23(2,3)18-13-15-24(16-14-18)25-20-12-8-7-11-19(20)22(29)27(24)26-21(28)17-9-5-4-6-10-17/h4-12,18,25H,13-16H2,1-3H3,(H,26,28) |
| InChIKey | NEEJUOIQPCABEN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |