C11H10N4O3 — CID 139227717
3-(phenacylamino)-1H-1,2,4-triazole-5-carboxylic acid (PubChem CID 139227717) has the molecular formula C11H10N4O3 and a molecular weight of 246.23 g/mol. Its IUPAC name is 3-(phenacylamino)-1H-1,2,4-triazole-5-carboxylic acid.
| Compound Name | 3-(phenacylamino)-1H-1,2,4-triazole-5-carboxylic acid |
|---|---|
| PubChem CID | 139227717 |
| Molecular Formula | C11H10N4O3 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 3-(phenacylamino)-1H-1,2,4-triazole-5-carboxylic acid |
| SMILES | O=C(CNc1n[nH]c(C(=O)O)n1)c1ccccc1 |
| InChI | InChI=1S/C11H10N4O3/c16-8(7-4-2-1-3-5-7)6-12-11-13-9(10(17)18)14-15-11/h1-5H,6H2,(H,17,18)(H2,12,13,14,15) |
| InChIKey | DYSQZZQRTSJPKI-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |