C27H22N2O3 — CID 139231565
7-(2-hydroxyphenyl)-6-phenyl-2,3,4,9,10,11-hexahydroindolo[1,2-a]quinoxaline-1,8-dione (PubChem CID 139231565) has the molecular formula C27H22N2O3 and a molecular weight of 422.48 g/mol. Its IUPAC name is 7-(2-hydroxyphenyl)-6-phenyl-2,3,4,9,10,11-hexahydroindolo[1,2-a]quinoxaline-1,8-dione.
| Compound Name | 7-(2-hydroxyphenyl)-6-phenyl-2,3,4,9,10,11-hexahydroindolo[1,2-a]quinoxaline-1,8-dione |
|---|---|
| PubChem CID | 139231565 |
| Molecular Formula | C27H22N2O3 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 7-(2-hydroxyphenyl)-6-phenyl-2,3,4,9,10,11-hexahydroindolo[1,2-a]quinoxaline-1,8-dione |
| SMILES | O=C1CCCc2c1c(-c1ccccc1O)c1c(-c3ccccc3)nc3c(n21)C(=O)CCC3 |
| InChI | InChI=1S/C27H22N2O3/c30-20-13-5-4-10-17(20)23-24-19(12-7-14-21(24)31)29-26-18(11-6-15-22(26)32)28-25(27(23)29)16-8-2-1-3-9-16/h1-5,8-10,13,30H,6-7,11-12,14-15H2 |
| InChIKey | OFETWVRUPWOFAF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |