C29H20N4OS — CID 139231633
N-(1,3-benzothiazol-2-yl)-1,3,5-triphenylpyrazole-4-carboxamide (PubChem CID 139231633) has the molecular formula C29H20N4OS and a molecular weight of 472.57 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-1,3,5-triphenylpyrazole-4-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-1,3,5-triphenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 139231633 |
| Molecular Formula | C29H20N4OS |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-1,3,5-triphenylpyrazole-4-carboxamide |
| SMILES | O=C(Nc1nc2ccccc2s1)c1c(-c2ccccc2)nn(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C29H20N4OS/c34-28(31-29-30-23-18-10-11-19-24(23)35-29)25-26(20-12-4-1-5-13-20)32-33(22-16-8-3-9-17-22)27(25)21-14-6-2-7-15-21/h1-19H,(H,30,31,34) |
| InChIKey | GVEZIZWWFXCBMW-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |