C33H24N8OS — CID 135908164
3-anilino-N-(1,3-benzothiazol-2-yl)-5-[(Z)-(1,3-diphenylpyrazol-4-yl)methylideneamino]-1H-pyrazole-4-carboxamide (PubChem CID 135908164) has the molecular formula C33H24N8OS and a molecular weight of 580.68 g/mol. Its IUPAC name is 3-anilino-N-(1,3-benzothiazol-2-yl)-5-[(Z)-(1,3-diphenylpyrazol-4-yl)methylideneamino]-1H-pyrazole-4-carboxamide.
| Compound Name | 3-anilino-N-(1,3-benzothiazol-2-yl)-5-[(Z)-(1,3-diphenylpyrazol-4-yl)methylideneamino]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 135908164 |
| Molecular Formula | C33H24N8OS |
| Molecular Weight | 580.68 g/mol |
| Exact Mass | 580.18 |
| IUPAC Name | 3-anilino-N-(1,3-benzothiazol-2-yl)-5-[(Z)-(1,3-diphenylpyrazol-4-yl)methylideneamino]-1H-pyrazole-4-carboxamide |
| SMILES | O=C(Nc1nc2ccccc2s1)c1c(Nc2ccccc2)n[nH]c1/N=C\c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C33H24N8OS/c42-32(37-33-36-26-18-10-11-19-27(26)43-33)28-30(38-39-31(28)35-24-14-6-2-7-15-24)34-20-23-21-41(25-16-8-3-9-17-25)40-29(23)22-12-4-1-5-13-22/h1-21H,(H2,35,38,39)(H,36,37,42)/b34-20- |
| InChIKey | HZASJPPFUWLGNB-GXBUFBABSA-N |
| XLogP | 7.62 |
| TPSA | 112.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.68 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|