C16H15N2O2P — CID 1392346
5-hydroxy-3,7-diphenyl-4,6-dihydro-1,2,5lambda5-diazaphosphepine 5-oxide (PubChem CID 1392346) has the molecular formula C16H15N2O2P and a molecular weight of 298.28 g/mol. Its IUPAC name is 5-hydroxy-3,7-diphenyl-4,6-dihydro-1,2,5lambda5-diazaphosphepine 5-oxide.
| Compound Name | 5-hydroxy-3,7-diphenyl-4,6-dihydro-1,2,5lambda5-diazaphosphepine 5-oxide |
|---|---|
| PubChem CID | 1392346 |
| Molecular Formula | C16H15N2O2P |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 5-hydroxy-3,7-diphenyl-4,6-dihydro-1,2,5lambda5-diazaphosphepine 5-oxide |
| SMILES | O=P1(O)CC(c2ccccc2)=NN=C(c2ccccc2)C1 |
| InChI | InChI=1S/C16H15N2O2P/c19-21(20)11-15(13-7-3-1-4-8-13)17-18-16(12-21)14-9-5-2-6-10-14/h1-10H,11-12H2,(H,19,20) |
| InChIKey | DXJNOAAATUNVKB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 62.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|