C20H18N4O3S — CID 139238898
2,5-bis(1-pyridin-2-ylethylideneamino)benzenesulfonic acid (PubChem CID 139238898) has the molecular formula C20H18N4O3S and a molecular weight of 394.46 g/mol. Its IUPAC name is 2,5-bis(1-pyridin-2-ylethylideneamino)benzenesulfonic acid.
| Compound Name | 2,5-bis(1-pyridin-2-ylethylideneamino)benzenesulfonic acid |
|---|---|
| PubChem CID | 139238898 |
| Molecular Formula | C20H18N4O3S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 2,5-bis(1-pyridin-2-ylethylideneamino)benzenesulfonic acid |
| SMILES | C/C(=N\c1ccc(/N=C(\C)c2ccccn2)c(S(=O)(=O)O)c1)c1ccccn1 |
| InChI | InChI=1S/C20H18N4O3S/c1-14(17-7-3-5-11-21-17)23-16-9-10-19(20(13-16)28(25,26)27)24-15(2)18-8-4-6-12-22-18/h3-13H,1-2H3,(H,25,26,27)/b23-14+,24-15+ |
| InChIKey | AWGNJWLVFPFVHU-OZEVPFDHSA-N |
| XLogP | 4.00 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|