C6H4N2O5S — CID 129302299
2,5-dinitrosobenzenesulfonic acid (PubChem CID 129302299) has the molecular formula C6H4N2O5S and a molecular weight of 216.17 g/mol. Its IUPAC name is 2,5-dinitrosobenzenesulfonic acid.
| Compound Name | 2,5-dinitrosobenzenesulfonic acid |
|---|---|
| PubChem CID | 129302299 |
| Molecular Formula | C6H4N2O5S |
| Molecular Weight | 216.17 g/mol |
| Exact Mass | 215.98 |
| IUPAC Name | 2,5-dinitrosobenzenesulfonic acid |
| SMILES | O=Nc1ccc(N=O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C6H4N2O5S/c9-7-4-1-2-5(8-10)6(3-4)14(11,12)13/h1-3H,(H,11,12,13) |
| InChIKey | BXIBUZOHYCCUPP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 113.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.17 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|