2,5-dinitrosobenzenesulfonic acid

C6H4N2O5S — CID 129302299

IUPAC2,5-dinitrosobenzenesulfonic acid
SMILESO=Nc1ccc(N=O)c(S(=O)(=O)O)c1
InChIInChI=1S/C6H4N2O5S/c9-7-4-1-2-5(8-10)6(3-4)14(11,12)13/h1-3H,(H,11,12,13)
InChIKeyBXIBUZOHYCCUPP-UHFFFAOYSA-N
MW216.17 g/mol
LogP1.73
Rot. Bonds3

About 2,5-dinitrosobenzenesulfonic acid

2,5-dinitrosobenzenesulfonic acid (PubChem CID 129302299) has the molecular formula C6H4N2O5S and a molecular weight of 216.17 g/mol. Its IUPAC name is 2,5-dinitrosobenzenesulfonic acid.

Molecular Properties

Compound Name2,5-dinitrosobenzenesulfonic acid
PubChem CID129302299
Molecular FormulaC6H4N2O5S
Molecular Weight216.17 g/mol
Exact Mass215.98
IUPAC Name2,5-dinitrosobenzenesulfonic acid
SMILESO=Nc1ccc(N=O)c(S(=O)(=O)O)c1
InChIInChI=1S/C6H4N2O5S/c9-7-4-1-2-5(8-10)6(3-4)14(11,12)13/h1-3H,(H,11,12,13)
InChIKeyBXIBUZOHYCCUPP-UHFFFAOYSA-N
XLogP1.73
TPSA113.23 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.17
LogP ≤ 51.73
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2,5-dinitrosobenzenesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-dinitrosobenzenesulfonic acid?
The IUPAC name of 2,5-dinitrosobenzenesulfonic acid (CID 129302299) is 2,5-dinitrosobenzenesulfonic acid.
What is the SMILES notation for 2,5-dinitrosobenzenesulfonic acid?
The canonical SMILES for 2,5-dinitrosobenzenesulfonic acid is O=Nc1ccc(N=O)c(S(=O)(=O)O)c1.
What is the InChIKey of 2,5-dinitrosobenzenesulfonic acid?
The InChIKey is BXIBUZOHYCCUPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O5S/c9-7-4-1-2-5(8-10)6(3-4)14(11,12)13/h1-3H,(H,11,12,13).
What are the key properties of 2,5-dinitrosobenzenesulfonic acid?
2,5-dinitrosobenzenesulfonic acid has a molecular weight of 216.17 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dinitrosobenzenesulfonic acid is sourced from PubChem (CID 129302299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).