C16H14N4Na2O8S2 — CID 122404064
disodium;N-[4-[[4-(1-oxidoethylideneamino)-3-sulfophenyl]diazenyl]-2-sulfophenyl]ethanimidate (PubChem CID 122404064) has the molecular formula C16H14N4Na2O8S2 and a molecular weight of 500.42 g/mol. Its IUPAC name is disodium;N-[4-[[4-(1-oxidoethylideneamino)-3-sulfophenyl]diazenyl]-2-sulfophenyl]ethanimidate.
| Compound Name | disodium;N-[4-[[4-(1-oxidoethylideneamino)-3-sulfophenyl]diazenyl]-2-sulfophenyl]ethanimidate |
|---|---|
| PubChem CID | 122404064 |
| Molecular Formula | C16H14N4Na2O8S2 |
| Molecular Weight | 500.42 g/mol |
| Exact Mass | 500.00 |
| IUPAC Name | disodium;N-[4-[[4-(1-oxidoethylideneamino)-3-sulfophenyl]diazenyl]-2-sulfophenyl]ethanimidate |
| SMILES | C/C([O-])=N\c1ccc(/N=N/c2ccc(/N=C(\C)[O-])c(S(=O)(=O)O)c2)cc1S(=O)(=O)O.[Na+].[Na+] |
| InChI | InChI=1S/C16H16N4O8S2.2Na/c1-9(21)17-13-5-3-11(7-15(13)29(23,24)25)19-20-12-4-6-14(18-10(2)22)16(8-12)30(26,27)28;;/h3-8H,1-2H3,(H,17,21)(H,18,22)(H,23,24,25)(H,26,27,28);;/q;2*+1/p-2/b20-19+;; |
| InChIKey | SKPKPGLEDMLCMP-LLIZZRELSA-L |
| XLogP | -4.58 |
| TPSA | 204.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.42 |
| LogP ≤ 5 | -4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|