C14H16N3+ — CID 139241002
4-(3-prop-2-enylbenzimidazol-1-ium-1-yl)butanenitrile (PubChem CID 139241002) has the molecular formula C14H16N3+ and a molecular weight of 226.30 g/mol. Its IUPAC name is 4-(3-prop-2-enylbenzimidazol-1-ium-1-yl)butanenitrile.
| Compound Name | 4-(3-prop-2-enylbenzimidazol-1-ium-1-yl)butanenitrile |
|---|---|
| PubChem CID | 139241002 |
| Molecular Formula | C14H16N3+ |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 4-(3-prop-2-enylbenzimidazol-1-ium-1-yl)butanenitrile |
| SMILES | C=CCn1c[n+](CCCC#N)c2ccccc21 |
| InChI | InChI=1S/C14H16N3/c1-2-10-16-12-17(11-6-5-9-15)14-8-4-3-7-13(14)16/h2-4,7-8,12H,1,5-6,10-11H2/q+1 |
| InChIKey | NWFQTAMPQWXVGO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 32.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|