C20H21N2O3+ — CID 3714536
1-(2,4-dimethoxyphenyl)-2-(3-prop-2-enylbenzimidazol-1-ium-1-yl)ethanone (PubChem CID 3714536) has the molecular formula C20H21N2O3+ and a molecular weight of 337.40 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-2-(3-prop-2-enylbenzimidazol-1-ium-1-yl)ethanone.
| Compound Name | 1-(2,4-dimethoxyphenyl)-2-(3-prop-2-enylbenzimidazol-1-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 3714536 |
| Molecular Formula | C20H21N2O3+ |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-2-(3-prop-2-enylbenzimidazol-1-ium-1-yl)ethanone |
| SMILES | C=CCn1c[n+](CC(=O)c2ccc(OC)cc2OC)c2ccccc21 |
| InChI | InChI=1S/C20H21N2O3/c1-4-11-21-14-22(18-8-6-5-7-17(18)21)13-19(23)16-10-9-15(24-2)12-20(16)25-3/h4-10,12,14H,1,11,13H2,2-3H3/q+1 |
| InChIKey | VBZWWCZVEHAYQK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 44.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|