About 1-phenylpyridin-1-ium acetate
1-phenylpyridin-1-ium acetate (PubChem CID 139243497) has the molecular formula C13H13NO2
and a molecular weight of 215.25 g/mol. Its IUPAC name is 1-phenylpyridin-1-ium acetate.
Molecular Properties
| Compound Name | 1-phenylpyridin-1-ium acetate |
| PubChem CID | 139243497 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 1-phenylpyridin-1-ium acetate |
| SMILES | CC(=O)[O-].c1ccc(-[n+]2ccccc2)cc1 |
| InChI | InChI=1S/C11H10N.C2H4O2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2(3)4/h1-10H;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey | NIHQTVWEHZPVAV-UHFFFAOYSA-M |
| XLogP | 0.72 |
| TPSA | 44.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylpyridin-1-ium acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpyridin-1-ium acetate?
The IUPAC name of 1-phenylpyridin-1-ium acetate (CID 139243497) is 1-phenylpyridin-1-ium acetate.
What is the SMILES notation for 1-phenylpyridin-1-ium acetate?
The canonical SMILES for 1-phenylpyridin-1-ium acetate is CC(=O)[O-].c1ccc(-[n+]2ccccc2)cc1.
What is the InChIKey of 1-phenylpyridin-1-ium acetate?
The InChIKey is NIHQTVWEHZPVAV-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H10N.C2H4O2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2(3)4/h1-10H;1H3,(H,3,4)/q+1;/p-1.
What are the key properties of 1-phenylpyridin-1-ium acetate?
1-phenylpyridin-1-ium acetate has a molecular weight of 215.25 g/mol, XLogP of 0.72, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpyridin-1-ium acetate is sourced from PubChem (CID 139243497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).