C34H36N24O12 — CID 139247396
CID 139247396 (PubChem CID 139247396) has the molecular formula C34H36N24O12 and a molecular weight of 972.82 g/mol.
| Compound Name | CID 139247396 |
|---|---|
| PubChem CID | 139247396 |
| Molecular Formula | C34H36N24O12 |
| Molecular Weight | 972.82 g/mol |
| Exact Mass | 972.29 |
| IUPAC Name | — |
| SMILES | O=C1N2CN3C(=O)N[C@@H]4[C@H]3N3CN5C(=O)N6CN7C(=O)N(CN8C(=O)N9CN%10C(=O)N%11CN%12C(=O)N(CN4C3=O)[C@@H]3NC(=O)N(CN4C(=O)N(CN%13C(=O)N[C@H]8[C@@H]%139)[C@H]%10[C@@H]4%11)[C@@H]3%12)[C@H]3NC(=O)N(CN1[C@H]6[C@@H]25)[C@H]37 |
| InChI | InChI=1S/C34H36N24O12/c59-23-35-11-15-43(23)3-51-19-21-53(31(51)67)5-45-17-13(37-25(45)61)41-2-42-14-18-46(26(62)38-14)6-54-22-20-52(32(54)68)4-44-16-12(36-24(44)60)40(28(64)48(16)8-56(20)34(70)58(22)10-50(18)30(42)66)1-39(11)27(63)47(15)7-55(19)33(69)57(21)9-49(17)29(41)65/h11-22H,1-10H2,(H,35,59)(H,36,60)(H,37,61)(H,38,62)/t11-,12-,13+,14+,15+,16+,17-,18-,19-,20-,21+,22+ |
| InChIKey | XKTLSPYFEIKRSB-ONMJGFMWSA-N |
| XLogP | -6.46 |
| TPSA | 317.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 972.82 |
| LogP ≤ 5 | -6.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |