C14H27O5P — CID 139249507
[(1S,2R)-2-tert-butylcyclohexyl] 2-dimethoxyphosphorylacetate (PubChem CID 139249507) has the molecular formula C14H27O5P and a molecular weight of 306.34 g/mol. Its IUPAC name is [(1S,2R)-2-tert-butylcyclohexyl] 2-dimethoxyphosphorylacetate.
| Compound Name | [(1S,2R)-2-tert-butylcyclohexyl] 2-dimethoxyphosphorylacetate |
|---|---|
| PubChem CID | 139249507 |
| Molecular Formula | C14H27O5P |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | [(1S,2R)-2-tert-butylcyclohexyl] 2-dimethoxyphosphorylacetate |
| SMILES | COP(=O)(CC(=O)O[C@H]1CCCC[C@@H]1C(C)(C)C)OC |
| InChI | InChI=1S/C14H27O5P/c1-14(2,3)11-8-6-7-9-12(11)19-13(15)10-20(16,17-4)18-5/h11-12H,6-10H2,1-5H3/t11-,12-/m0/s1 |
| InChIKey | CQUYBJQMKWEUJY-RYUDHWBXSA-N |
| XLogP | 3.62 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|