C17H22F3NO — CID 139250973
[(E)-hept-3-en-2-yl] 2,2,2-trifluoro-N-(2-phenylethyl)ethanimidate (PubChem CID 139250973) has the molecular formula C17H22F3NO and a molecular weight of 313.36 g/mol. Its IUPAC name is [(E)-hept-3-en-2-yl] 2,2,2-trifluoro-N-(2-phenylethyl)ethanimidate.
| Compound Name | [(E)-hept-3-en-2-yl] 2,2,2-trifluoro-N-(2-phenylethyl)ethanimidate |
|---|---|
| PubChem CID | 139250973 |
| Molecular Formula | C17H22F3NO |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | [(E)-hept-3-en-2-yl] 2,2,2-trifluoro-N-(2-phenylethyl)ethanimidate |
| SMILES | CCC/C=C/C(C)O/C(=N\CCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H22F3NO/c1-3-4-6-9-14(2)22-16(17(18,19)20)21-13-12-15-10-7-5-8-11-15/h5-11,14H,3-4,12-13H2,1-2H3/b9-6+,21-16- |
| InChIKey | GLYGHWFKTFRLNY-QZIPBAJESA-N |
| XLogP | 4.95 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|