C16H20F3NO — CID 139250974
[(E)-hex-3-en-2-yl] 2,2,2-trifluoro-N-(2-phenylethyl)ethanimidate (PubChem CID 139250974) has the molecular formula C16H20F3NO and a molecular weight of 299.34 g/mol. Its IUPAC name is [(E)-hex-3-en-2-yl] 2,2,2-trifluoro-N-(2-phenylethyl)ethanimidate.
| Compound Name | [(E)-hex-3-en-2-yl] 2,2,2-trifluoro-N-(2-phenylethyl)ethanimidate |
|---|---|
| PubChem CID | 139250974 |
| Molecular Formula | C16H20F3NO |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | [(E)-hex-3-en-2-yl] 2,2,2-trifluoro-N-(2-phenylethyl)ethanimidate |
| SMILES | CC/C=C/C(C)O/C(=N\CCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H20F3NO/c1-3-4-8-13(2)21-15(16(17,18)19)20-12-11-14-9-6-5-7-10-14/h4-10,13H,3,11-12H2,1-2H3/b8-4+,20-15- |
| InChIKey | ADKFYHZLHHHLQO-UCFZCCJSSA-N |
| XLogP | 4.56 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|