C21H30F3NO — CID 139250978
[(E)-7-phenylhept-4-en-3-yl] 2,2,2-trifluoro-N-hexylethanimidate (PubChem CID 139250978) has the molecular formula C21H30F3NO and a molecular weight of 369.47 g/mol. Its IUPAC name is [(E)-7-phenylhept-4-en-3-yl] 2,2,2-trifluoro-N-hexylethanimidate.
| Compound Name | [(E)-7-phenylhept-4-en-3-yl] 2,2,2-trifluoro-N-hexylethanimidate |
|---|---|
| PubChem CID | 139250978 |
| Molecular Formula | C21H30F3NO |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | [(E)-7-phenylhept-4-en-3-yl] 2,2,2-trifluoro-N-hexylethanimidate |
| SMILES | CCCCCC/N=C(/OC(/C=C/CCc1ccccc1)CC)C(F)(F)F |
| InChI | InChI=1S/C21H30F3NO/c1-3-5-6-12-17-25-20(21(22,23)24)26-19(4-2)16-11-10-15-18-13-8-7-9-14-18/h7-9,11,13-14,16,19H,3-6,10,12,15,17H2,1-2H3/b16-11+,25-20+ |
| InChIKey | SGBKVUJLCXHOFC-OVZAPSBOSA-N |
| XLogP | 6.51 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|