C10H19NO5S — CID 139251521
4-[2-[2-[(2-sulfanylacetyl)amino]ethoxy]ethoxy]butanoic acid (PubChem CID 139251521) has the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. Its IUPAC name is 4-[2-[2-[(2-sulfanylacetyl)amino]ethoxy]ethoxy]butanoic acid.
| Compound Name | 4-[2-[2-[(2-sulfanylacetyl)amino]ethoxy]ethoxy]butanoic acid |
|---|---|
| PubChem CID | 139251521 |
| Molecular Formula | C10H19NO5S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 4-[2-[2-[(2-sulfanylacetyl)amino]ethoxy]ethoxy]butanoic acid |
| SMILES | O=C(O)CCCOCCOCCNC(=O)CS |
| InChI | InChI=1S/C10H19NO5S/c12-9(8-17)11-3-5-16-7-6-15-4-1-2-10(13)14/h17H,1-8H2,(H,11,12)(H,13,14) |
| InChIKey | LFNDQUNKDIIAIM-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|