C38H43NO4Si — CID 139254690
4,4-dimethyl-3-[(2R,3R)-2-phenyl-3-triphenylsilyloxynonanoyl]-1,3-oxazolidin-2-one (PubChem CID 139254690) has the molecular formula C38H43NO4Si and a molecular weight of 605.85 g/mol. Its IUPAC name is 4,4-dimethyl-3-[(2R,3R)-2-phenyl-3-triphenylsilyloxynonanoyl]-1,3-oxazolidin-2-one.
| Compound Name | 4,4-dimethyl-3-[(2R,3R)-2-phenyl-3-triphenylsilyloxynonanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139254690 |
| Molecular Formula | C38H43NO4Si |
| Molecular Weight | 605.85 g/mol |
| Exact Mass | 605.30 |
| IUPAC Name | 4,4-dimethyl-3-[(2R,3R)-2-phenyl-3-triphenylsilyloxynonanoyl]-1,3-oxazolidin-2-one |
| SMILES | CCCCCC[C@@H](O[Si](c1ccccc1)(c1ccccc1)c1ccccc1)[C@H](C(=O)N1C(=O)OCC1(C)C)c1ccccc1 |
| InChI | InChI=1S/C38H43NO4Si/c1-4-5-6-19-28-34(35(30-20-11-7-12-21-30)36(40)39-37(41)42-29-38(39,2)3)43-44(31-22-13-8-14-23-31,32-24-15-9-16-25-32)33-26-17-10-18-27-33/h7-18,20-27,34-35H,4-6,19,28-29H2,1-3H3/t34-,35-/m1/s1 |
| InChIKey | XOGSQHWXMPUVST-VSJLXWSYSA-N |
| XLogP | 6.55 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.85 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|