C38H41NO4Si — CID 139254691
3-[(2R,3S)-2-cyclohexyl-3-phenyl-3-triphenylsilyloxypropanoyl]-4,4-dimethyl-1,3-oxazolidin-2-one (PubChem CID 139254691) has the molecular formula C38H41NO4Si and a molecular weight of 603.84 g/mol. Its IUPAC name is 3-[(2R,3S)-2-cyclohexyl-3-phenyl-3-triphenylsilyloxypropanoyl]-4,4-dimethyl-1,3-oxazolidin-2-one.
| Compound Name | 3-[(2R,3S)-2-cyclohexyl-3-phenyl-3-triphenylsilyloxypropanoyl]-4,4-dimethyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139254691 |
| Molecular Formula | C38H41NO4Si |
| Molecular Weight | 603.84 g/mol |
| Exact Mass | 603.28 |
| IUPAC Name | 3-[(2R,3S)-2-cyclohexyl-3-phenyl-3-triphenylsilyloxypropanoyl]-4,4-dimethyl-1,3-oxazolidin-2-one |
| SMILES | CC1(C)COC(=O)N1C(=O)[C@H](C1CCCCC1)[C@H](O[Si](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H41NO4Si/c1-38(2)28-42-37(41)39(38)36(40)34(29-18-8-3-9-19-29)35(30-20-10-4-11-21-30)43-44(31-22-12-5-13-23-31,32-24-14-6-15-25-32)33-26-16-7-17-27-33/h4-7,10-17,20-27,29,34-35H,3,8-9,18-19,28H2,1-2H3/t34-,35-/m1/s1 |
| InChIKey | QGOCOCOBECQEDX-VSJLXWSYSA-N |
| XLogP | 6.37 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.84 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|