C43H47NO5Si — CID 134865703
(4S)-4-benzyl-3-[(2S)-6-[tert-butyl(diphenyl)silyl]oxy-2-[(S)-hydroxy(naphthalen-1-yl)methyl]hexanoyl]-1,3-oxazolidin-2-one (PubChem CID 134865703) has the molecular formula C43H47NO5Si and a molecular weight of 685.94 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2S)-6-[tert-butyl(diphenyl)silyl]oxy-2-[(S)-hydroxy(naphthalen-1-yl)methyl]hexanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2S)-6-[tert-butyl(diphenyl)silyl]oxy-2-[(S)-hydroxy(naphthalen-1-yl)methyl]hexanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134865703 |
| Molecular Formula | C43H47NO5Si |
| Molecular Weight | 685.94 g/mol |
| Exact Mass | 685.32 |
| IUPAC Name | (4S)-4-benzyl-3-[(2S)-6-[tert-butyl(diphenyl)silyl]oxy-2-[(S)-hydroxy(naphthalen-1-yl)methyl]hexanoyl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)(C)[Si](OCCCC[C@H](C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)[C@H](O)c1cccc2ccccc12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H47NO5Si/c1-43(2,3)50(35-22-9-5-10-23-35,36-24-11-6-12-25-36)49-29-16-15-27-39(40(45)38-28-17-21-33-20-13-14-26-37(33)38)41(46)44-34(31-48-42(44)47)30-32-18-7-4-8-19-32/h4-14,17-26,28,34,39-40,45H,15-16,27,29-31H2,1-3H3/t34-,39-,40+/m0/s1 |
| InChIKey | NPHMJUJKWUGLSD-SEQRUIBASA-N |
| XLogP | 7.83 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.94 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|