C16H18O3 — CID 139254967
(2S,5R,10S)-10-hydroxy-2-phenylspiro[4.5]decane-4,9-dione (PubChem CID 139254967) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is (2S,5R,10S)-10-hydroxy-2-phenylspiro[4.5]decane-4,9-dione.
| Compound Name | (2S,5R,10S)-10-hydroxy-2-phenylspiro[4.5]decane-4,9-dione |
|---|---|
| PubChem CID | 139254967 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | (2S,5R,10S)-10-hydroxy-2-phenylspiro[4.5]decane-4,9-dione |
| SMILES | O=C1CCC[C@@]2(C[C@H](c3ccccc3)CC2=O)[C@@H]1O |
| InChI | InChI=1S/C16H18O3/c17-13-7-4-8-16(15(13)19)10-12(9-14(16)18)11-5-2-1-3-6-11/h1-3,5-6,12,15,19H,4,7-10H2/t12-,15-,16+/m1/s1 |
| InChIKey | BAHIRSTYRGDKLR-WQVCFCJDSA-N |
| XLogP | 2.23 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |