C20H25N3O2 — CID 139255367
6,7-diimino-2-octylbenzo[de]isoquinoline-1,3-diol (PubChem CID 139255367) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 6,7-diimino-2-octylbenzo[de]isoquinoline-1,3-diol.
| Compound Name | 6,7-diimino-2-octylbenzo[de]isoquinoline-1,3-diol |
|---|---|
| PubChem CID | 139255367 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 6,7-diimino-2-octylbenzo[de]isoquinoline-1,3-diol |
| SMILES | [H]/N=c1\ccc2c(O)n(CCCCCCCC)c(O)c3cc/c(=N\[H])c1c23 |
| InChI | InChI=1S/C20H25N3O2/c1-2-3-4-5-6-7-12-23-19(24)13-8-10-15(21)18-16(22)11-9-14(17(13)18)20(23)25/h8-11,21-22,24-25H,2-7,12H2,1H3/b21-15+,22-16+ |
| InChIKey | RYOPZAHFZMFEJL-YHARCJFQSA-N |
| XLogP | 3.96 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_6_pyridone_OH(5)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|