C27H28N4O6 — CID 135926294
16-hydroxy-5-methoxy-10,17-dipentyl-3,6,10,17-tetrazapentacyclo[10.6.2.02,7.08,20.015,19]icosa-1(19),2,5,7,12(20),13,15-heptaene-4,9,11,18-tetrone (PubChem CID 135926294) has the molecular formula C27H28N4O6 and a molecular weight of 504.54 g/mol. Its IUPAC name is 16-hydroxy-5-methoxy-10,17-dipentyl-3,6,10,17-tetrazapentacyclo[10.6.2.02,7.08,20.015,19]icosa-1(19),2,5,7,12(20),13,15-heptaene-4,9,11,18-tetrone.
| Compound Name | 16-hydroxy-5-methoxy-10,17-dipentyl-3,6,10,17-tetrazapentacyclo[10.6.2.02,7.08,20.015,19]icosa-1(19),2,5,7,12(20),13,15-heptaene-4,9,11,18-tetrone |
|---|---|
| PubChem CID | 135926294 |
| Molecular Formula | C27H28N4O6 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | 16-hydroxy-5-methoxy-10,17-dipentyl-3,6,10,17-tetrazapentacyclo[10.6.2.02,7.08,20.015,19]icosa-1(19),2,5,7,12(20),13,15-heptaene-4,9,11,18-tetrone |
| SMILES | CCCCCn1c(O)c2ccc3c(=O)n(CCCCC)c(=O)c4c5nc(OC)c(=O)nc5c(c1=O)c2c34 |
| InChI | InChI=1S/C27H28N4O6/c1-4-6-8-12-30-24(33)14-10-11-15-17-16(14)18(26(30)35)20-21(29-23(37-3)22(32)28-20)19(17)27(36)31(25(15)34)13-9-7-5-2/h10-11,33H,4-9,12-13H2,1-3H3 |
| InChIKey | HKMGNRYPEGELSX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 133.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|