C26H30N4O4 — CID 135926350
11,16-dihydroxy-10,17-dipentyl-3,6,10,17-tetrazapentacyclo[10.6.2.02,7.08,20.015,19]icosa-1(19),2,6,8(20),11,13,15-heptaene-9,18-dione (PubChem CID 135926350) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is 11,16-dihydroxy-10,17-dipentyl-3,6,10,17-tetrazapentacyclo[10.6.2.02,7.08,20.015,19]icosa-1(19),2,6,8(20),11,13,15-heptaene-9,18-dione.
| Compound Name | 11,16-dihydroxy-10,17-dipentyl-3,6,10,17-tetrazapentacyclo[10.6.2.02,7.08,20.015,19]icosa-1(19),2,6,8(20),11,13,15-heptaene-9,18-dione |
|---|---|
| PubChem CID | 135926350 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 11,16-dihydroxy-10,17-dipentyl-3,6,10,17-tetrazapentacyclo[10.6.2.02,7.08,20.015,19]icosa-1(19),2,6,8(20),11,13,15-heptaene-9,18-dione |
| SMILES | CCCCCn1c(O)c2ccc3c(O)n(CCCCC)c(=O)c4c5c(c(c1=O)c2c34)=NCCN=5 |
| InChI | InChI=1S/C26H30N4O4/c1-3-5-7-13-29-23(31)15-9-10-16-18-17(15)19(25(29)33)21-22(28-12-11-27-21)20(18)26(34)30(24(16)32)14-8-6-4-2/h9-10,31-32H,3-8,11-14H2,1-2H3 |
| InChIKey | IWEYTIYGFJUNJY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 109.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|