C27H24O8S — CID 139255565
methyl (2S,3S,4S,5R)-4,5-dibenzoyloxy-3-hydroxy-6-phenylsulfanyloxane-2-carboxylate (PubChem CID 139255565) has the molecular formula C27H24O8S and a molecular weight of 508.55 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R)-4,5-dibenzoyloxy-3-hydroxy-6-phenylsulfanyloxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R)-4,5-dibenzoyloxy-3-hydroxy-6-phenylsulfanyloxane-2-carboxylate |
|---|---|
| PubChem CID | 139255565 |
| Molecular Formula | C27H24O8S |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | methyl (2S,3S,4S,5R)-4,5-dibenzoyloxy-3-hydroxy-6-phenylsulfanyloxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1OC(Sc2ccccc2)[C@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C27H24O8S/c1-32-26(31)22-20(28)21(33-24(29)17-11-5-2-6-12-17)23(34-25(30)18-13-7-3-8-14-18)27(35-22)36-19-15-9-4-10-16-19/h2-16,20-23,27-28H,1H3/t20-,21-,22-,23+,27?/m0/s1 |
| InChIKey | OSRDPWAHVFTVEA-IBOFPESVSA-N |
| XLogP | 3.49 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|