C21H36O3Si — CID 139256632
(1R,2R,4S,7R,8S)-7-[tert-butyl(dimethyl)silyl]oxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undeca-5,9-dien-4-ol (PubChem CID 139256632) has the molecular formula C21H36O3Si and a molecular weight of 364.60 g/mol. Its IUPAC name is (1R,2R,4S,7R,8S)-7-[tert-butyl(dimethyl)silyl]oxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undeca-5,9-dien-4-ol.
| Compound Name | (1R,2R,4S,7R,8S)-7-[tert-butyl(dimethyl)silyl]oxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undeca-5,9-dien-4-ol |
|---|---|
| PubChem CID | 139256632 |
| Molecular Formula | C21H36O3Si |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | (1R,2R,4S,7R,8S)-7-[tert-butyl(dimethyl)silyl]oxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undeca-5,9-dien-4-ol |
| SMILES | CC1=C2[C@@H](C[C@@H]1O)[C@@]1(C)C=C[C@](C(C)C)(O1)[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H36O3Si/c1-13(2)21-11-10-20(7,24-21)15-12-16(22)14(3)17(15)18(21)23-25(8,9)19(4,5)6/h10-11,13,15-16,18,22H,12H2,1-9H3/t15-,16+,18-,20-,21-/m1/s1 |
| InChIKey | MZCLTVIJSWYQIX-YXYLECDTSA-N |
| XLogP | 4.83 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|