C31H41NO4Si — CID 139256929
methyl (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)-3-(4-methoxyphenyl)propanoate (PubChem CID 139256929) has the molecular formula C31H41NO4Si and a molecular weight of 519.76 g/mol. Its IUPAC name is methyl (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)-3-(4-methoxyphenyl)propanoate.
| Compound Name | methyl (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 139256929 |
| Molecular Formula | C31H41NO4Si |
| Molecular Weight | 519.76 g/mol |
| Exact Mass | 519.28 |
| IUPAC Name | methyl (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(dibenzylamino)-3-(4-methoxyphenyl)propanoate |
| SMILES | COC(=O)[C@H]([C@@H](O[Si](C)(C)C(C)(C)C)c1ccc(OC)cc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C31H41NO4Si/c1-31(2,3)37(6,7)36-29(26-18-20-27(34-4)21-19-26)28(30(33)35-5)32(22-24-14-10-8-11-15-24)23-25-16-12-9-13-17-25/h8-21,28-29H,22-23H2,1-7H3/t28-,29-/m0/s1 |
| InChIKey | BCDFXDUXROPECU-VMPREFPWSA-N |
| XLogP | 7.00 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.76 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|