C16H26O6Si — CID 139257725
methyl (2R)-2-[2-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-4-hydroxy-5-oxo-2H-furan-3-carboxylate (PubChem CID 139257725) has the molecular formula C16H26O6Si and a molecular weight of 342.46 g/mol. Its IUPAC name is methyl (2R)-2-[2-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-4-hydroxy-5-oxo-2H-furan-3-carboxylate.
| Compound Name | methyl (2R)-2-[2-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-4-hydroxy-5-oxo-2H-furan-3-carboxylate |
|---|---|
| PubChem CID | 139257725 |
| Molecular Formula | C16H26O6Si |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | methyl (2R)-2-[2-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-4-hydroxy-5-oxo-2H-furan-3-carboxylate |
| SMILES | C=CC(C[C@H]1OC(=O)C(O)=C1C(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H26O6Si/c1-8-10(22-23(6,7)16(2,3)4)9-11-12(14(18)20-5)13(17)15(19)21-11/h8,10-11,17H,1,9H2,2-7H3/t10?,11-/m1/s1 |
| InChIKey | QCFOVSLXLPQPGF-RRKGBCIJSA-N |
| XLogP | 2.86 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|