C17H30O5 — CID 139258199
(E,1R)-3-cyclopentyl-1-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]but-2-en-1-ol (PubChem CID 139258199) has the molecular formula C17H30O5 and a molecular weight of 314.42 g/mol. Its IUPAC name is (E,1R)-3-cyclopentyl-1-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]but-2-en-1-ol.
| Compound Name | (E,1R)-3-cyclopentyl-1-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]but-2-en-1-ol |
|---|---|
| PubChem CID | 139258199 |
| Molecular Formula | C17H30O5 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | (E,1R)-3-cyclopentyl-1-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]but-2-en-1-ol |
| SMILES | CO[C@]1(C)OC[C@@H]([C@H](O)/C=C(\C)C2CCCC2)O[C@@]1(C)OC |
| InChI | InChI=1S/C17H30O5/c1-12(13-8-6-7-9-13)10-14(18)15-11-21-16(2,19-4)17(3,20-5)22-15/h10,13-15,18H,6-9,11H2,1-5H3/b12-10+/t14-,15+,16-,17-/m1/s1 |
| InChIKey | MZRRVLZJAFAHKI-ZHJAHJERSA-N |
| XLogP | 2.62 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|