sodium 5-cyanotetrazole-5-carboxylate

C3N5NaO2 — CID 139258249

IUPACsodium 5-cyanotetrazole-5-carboxylate
SMILESN#CC1(C(=O)[O-])N=NN=N1.[Na+]
InChIInChI=1S/C3HN5O2.Na/c4-1-3(2(9)10)5-7-8-6-3;/h(H,9,10);/q;+1/p-1
InChIKeyUYMWDKQYZBFIDI-UHFFFAOYSA-M
MW161.06 g/mol
LogP-4.21
Rot. Bonds1

About sodium 5-cyanotetrazole-5-carboxylate

sodium 5-cyanotetrazole-5-carboxylate (PubChem CID 139258249) has the molecular formula C3N5NaO2 and a molecular weight of 161.06 g/mol. Its IUPAC name is sodium 5-cyanotetrazole-5-carboxylate.

Molecular Properties

Compound Namesodium 5-cyanotetrazole-5-carboxylate
PubChem CID139258249
Molecular FormulaC3N5NaO2
Molecular Weight161.06 g/mol
Exact Mass160.99
IUPAC Namesodium 5-cyanotetrazole-5-carboxylate
SMILESN#CC1(C(=O)[O-])N=NN=N1.[Na+]
InChIInChI=1S/C3HN5O2.Na/c4-1-3(2(9)10)5-7-8-6-3;/h(H,9,10);/q;+1/p-1
InChIKeyUYMWDKQYZBFIDI-UHFFFAOYSA-M
XLogP-4.21
TPSA113.36 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500161.06
LogP ≤ 5-4.21
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Analyze sodium 5-cyanotetrazole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 5-cyanotetrazole-5-carboxylate?
The IUPAC name of sodium 5-cyanotetrazole-5-carboxylate (CID 139258249) is sodium 5-cyanotetrazole-5-carboxylate.
What is the SMILES notation for sodium 5-cyanotetrazole-5-carboxylate?
The canonical SMILES for sodium 5-cyanotetrazole-5-carboxylate is N#CC1(C(=O)[O-])N=NN=N1.[Na+].
What is the InChIKey of sodium 5-cyanotetrazole-5-carboxylate?
The InChIKey is UYMWDKQYZBFIDI-UHFFFAOYSA-M. The full InChI is InChI=1S/C3HN5O2.Na/c4-1-3(2(9)10)5-7-8-6-3;/h(H,9,10);/q;+1/p-1.
What are the key properties of sodium 5-cyanotetrazole-5-carboxylate?
sodium 5-cyanotetrazole-5-carboxylate has a molecular weight of 161.06 g/mol, XLogP of -4.21, 1 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 5-cyanotetrazole-5-carboxylate is sourced from PubChem (CID 139258249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).