C20H24OSe2 — CID 139264964
(2S,7R)-2,7-bis(phenylselanylmethyl)oxepane (PubChem CID 139264964) has the molecular formula C20H24OSe2 and a molecular weight of 438.33 g/mol. Its IUPAC name is (2S,7R)-2,7-bis(phenylselanylmethyl)oxepane.
| Compound Name | (2S,7R)-2,7-bis(phenylselanylmethyl)oxepane |
|---|---|
| PubChem CID | 139264964 |
| Molecular Formula | C20H24OSe2 |
| Molecular Weight | 438.33 g/mol |
| Exact Mass | 440.02 |
| IUPAC Name | (2S,7R)-2,7-bis(phenylselanylmethyl)oxepane |
| SMILES | c1ccc([Se]C[C@H]2CCCC[C@@H](C[Se]c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C20H24OSe2/c1-3-11-19(12-4-1)22-15-17-9-7-8-10-18(21-17)16-23-20-13-5-2-6-14-20/h1-6,11-14,17-18H,7-10,15-16H2/t17-,18+ |
| InChIKey | SAPONQAQMCHOBM-HDICACEKSA-N |
| XLogP | 3.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|