C14H18O3Se — CID 10267560
4-(2-phenylselanylethyl)-1,3-dioxocan-2-one (PubChem CID 10267560) has the molecular formula C14H18O3Se and a molecular weight of 313.25 g/mol. Its IUPAC name is 4-(2-phenylselanylethyl)-1,3-dioxocan-2-one.
| Compound Name | 4-(2-phenylselanylethyl)-1,3-dioxocan-2-one |
|---|---|
| PubChem CID | 10267560 |
| Molecular Formula | C14H18O3Se |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 4-(2-phenylselanylethyl)-1,3-dioxocan-2-one |
| SMILES | O=C1OCCCCC(CC[Se]c2ccccc2)O1 |
| InChI | InChI=1S/C14H18O3Se/c15-14-16-10-5-4-6-12(17-14)9-11-18-13-7-2-1-3-8-13/h1-3,7-8,12H,4-6,9-11H2 |
| InChIKey | OHMPAWAVJALBEQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|