C21H21NO2SSe — CID 139266441
CID 139266441 (PubChem CID 139266441) has the molecular formula C21H21NO2SSe and a molecular weight of 430.43 g/mol.
| Compound Name | CID 139266441 |
|---|---|
| PubChem CID | 139266441 |
| Molecular Formula | C21H21NO2SSe |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | — |
| SMILES | Cc1ccc(S(=O)(=O)/N=[Se](\C/C=C/c2ccccc2)C2=CC=CC2)cc1 |
| InChI | InChI=1S/C21H21NO2SSe/c1-18-13-15-20(16-14-18)25(23,24)22-26(21-11-5-6-12-21)17-7-10-19-8-3-2-4-9-19/h2-11,13-16H,12,17H2,1H3/b10-7+ |
| InChIKey | RMNKMTTZQKTTGF-JXMROGBWSA-N |
| XLogP | 5.08 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|