C35H43Cl2N5O6 — CID 139270452
ethyl (2S)-2-[[4-[5-[4-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]piperazin-1-yl]pentoxy]-3,5-dichloro-2-hydroxybenzoyl]amino]-3-phenylpropanoate (PubChem CID 139270452) has the molecular formula C35H43Cl2N5O6 and a molecular weight of 700.66 g/mol. Its IUPAC name is ethyl (2S)-2-[[4-[5-[4-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]piperazin-1-yl]pentoxy]-3,5-dichloro-2-hydroxybenzoyl]amino]-3-phenylpropanoate.
| Compound Name | ethyl (2S)-2-[[4-[5-[4-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]piperazin-1-yl]pentoxy]-3,5-dichloro-2-hydroxybenzoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 139270452 |
| Molecular Formula | C35H43Cl2N5O6 |
| Molecular Weight | 700.66 g/mol |
| Exact Mass | 699.26 |
| IUPAC Name | ethyl (2S)-2-[[4-[5-[4-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]piperazin-1-yl]pentoxy]-3,5-dichloro-2-hydroxybenzoyl]amino]-3-phenylpropanoate |
| SMILES | C#CCCC1(CCC(=O)N2CCN(CCCCCOc3c(Cl)cc(C(=O)N[C@@H](Cc4ccccc4)C(=O)OCC)c(O)c3Cl)CC2)N=N1 |
| InChI | InChI=1S/C35H43Cl2N5O6/c1-3-5-15-35(39-40-35)16-14-29(43)42-20-18-41(19-21-42)17-10-7-11-22-48-32-27(36)24-26(31(44)30(32)37)33(45)38-28(34(46)47-4-2)23-25-12-8-6-9-13-25/h1,6,8-9,12-13,24,28,44H,4-5,7,10-11,14-23H2,2H3,(H,38,45)/t28-/m0/s1 |
| InChIKey | NAIHDCYSAQHROI-NDEPHWFRSA-N |
| XLogP | 5.65 |
| TPSA | 133.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.66 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|